C19H22N2O3S2 — CID 18998785
6-[[5-(4-methoxyoxan-4-yl)-1,3-thiazol-2-yl]sulfanyl]-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 18998785) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 6-[[5-(4-methoxyoxan-4-yl)-1,3-thiazol-2-yl]sulfanyl]-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[[5-(4-methoxyoxan-4-yl)-1,3-thiazol-2-yl]sulfanyl]-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 18998785 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 6-[[5-(4-methoxyoxan-4-yl)-1,3-thiazol-2-yl]sulfanyl]-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | COC1(c2cnc(Sc3ccc4c(c3)CCC(=O)N4C)s2)CCOCC1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-21-15-5-4-14(11-13(15)3-6-17(21)22)25-18-20-12-16(26-18)19(23-2)7-9-24-10-8-19/h4-5,11-12H,3,6-10H2,1-2H3 |
| InChIKey | KNPSGWHBSZMASJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|