C14H10N4S — CID 18999862
1-methyl-7-thiophen-3-ylpyrazolo[4,3-g]quinoxaline (PubChem CID 18999862) has the molecular formula C14H10N4S and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-methyl-7-thiophen-3-ylpyrazolo[4,3-g]quinoxaline.
| Compound Name | 1-methyl-7-thiophen-3-ylpyrazolo[4,3-g]quinoxaline |
|---|---|
| PubChem CID | 18999862 |
| Molecular Formula | C14H10N4S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1-methyl-7-thiophen-3-ylpyrazolo[4,3-g]quinoxaline |
| SMILES | Cn1ncc2cc3ncc(-c4ccsc4)nc3cc21 |
| InChI | InChI=1S/C14H10N4S/c1-18-14-5-12-11(4-10(14)6-16-18)15-7-13(17-12)9-2-3-19-8-9/h2-8H,1H3 |
| InChIKey | XLXHELZWKBISOM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |