C29H30F2NO9P — CID 19002309
3-[4-[bis(ethylperoxy)phosphoryl-difluoromethyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 19002309) has the molecular formula C29H30F2NO9P and a molecular weight of 605.53 g/mol. Its IUPAC name is 3-[4-[bis(ethylperoxy)phosphoryl-difluoromethyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[4-[bis(ethylperoxy)phosphoryl-difluoromethyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 19002309 |
| Molecular Formula | C29H30F2NO9P |
| Molecular Weight | 605.53 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | 3-[4-[bis(ethylperoxy)phosphoryl-difluoromethyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CCOOP(=O)(OOCC)C(F)(F)c1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C29H30F2NO9P/c1-3-38-40-42(36,41-39-4-2)29(30,31)20-15-13-19(14-16-20)17-26(27(33)34)32-28(35)37-18-25-23-11-7-5-9-21(23)22-10-6-8-12-24(22)25/h5-16,25-26H,3-4,17-18H2,1-2H3,(H,32,35)(H,33,34) |
| InChIKey | FHFRMPITOQXCLH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|