C19H13Cl2NO2 — CID 19004507
2,6-dichloro-4-(2-naphthalen-2-yloxyethoxy)benzonitrile (PubChem CID 19004507) has the molecular formula C19H13Cl2NO2 and a molecular weight of 358.22 g/mol. Its IUPAC name is 2,6-dichloro-4-(2-naphthalen-2-yloxyethoxy)benzonitrile.
| Compound Name | 2,6-dichloro-4-(2-naphthalen-2-yloxyethoxy)benzonitrile |
|---|---|
| PubChem CID | 19004507 |
| Molecular Formula | C19H13Cl2NO2 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2,6-dichloro-4-(2-naphthalen-2-yloxyethoxy)benzonitrile |
| SMILES | N#Cc1c(Cl)cc(OCCOc2ccc3ccccc3c2)cc1Cl |
| InChI | InChI=1S/C19H13Cl2NO2/c20-18-10-16(11-19(21)17(18)12-22)24-8-7-23-15-6-5-13-3-1-2-4-14(13)9-15/h1-6,9-11H,7-8H2 |
| InChIKey | NQJDUCYXTXNXLI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|