C20H14Cl2O5 — CID 19004330
2-[3,5-dichloro-4-(2-naphthalen-2-yloxyethoxy)phenyl]-2-oxoacetic acid (PubChem CID 19004330) has the molecular formula C20H14Cl2O5 and a molecular weight of 405.23 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(2-naphthalen-2-yloxyethoxy)phenyl]-2-oxoacetic acid.
| Compound Name | 2-[3,5-dichloro-4-(2-naphthalen-2-yloxyethoxy)phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 19004330 |
| Molecular Formula | C20H14Cl2O5 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 2-[3,5-dichloro-4-(2-naphthalen-2-yloxyethoxy)phenyl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1cc(Cl)c(OCCOc2ccc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2O5/c21-16-10-14(18(23)20(24)25)11-17(22)19(16)27-8-7-26-15-6-5-12-3-1-2-4-13(12)9-15/h1-6,9-11H,7-8H2,(H,24,25) |
| InChIKey | NWLHIJQOMMDEMD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|