C21H44N2O — CID 19004855
3-butyl-1,1-bis(2-ethylhexyl)urea (PubChem CID 19004855) has the molecular formula C21H44N2O and a molecular weight of 340.60 g/mol. Its IUPAC name is 3-butyl-1,1-bis(2-ethylhexyl)urea.
| Compound Name | 3-butyl-1,1-bis(2-ethylhexyl)urea |
|---|---|
| PubChem CID | 19004855 |
| Molecular Formula | C21H44N2O |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.35 |
| IUPAC Name | 3-butyl-1,1-bis(2-ethylhexyl)urea |
| SMILES | CCCCNC(=O)N(CC(CC)CCCC)CC(CC)CCCC |
| InChI | InChI=1S/C21H44N2O/c1-6-11-14-19(9-4)17-23(21(24)22-16-13-8-3)18-20(10-5)15-12-7-2/h19-20H,6-18H2,1-5H3,(H,22,24) |
| InChIKey | ZQUAWGMYCUEGNP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|