C9H16Na2O8P2 — CID 19008744
disodium;1-dimethoxyphosphoryl-7-phosphonatoheptane-1,7-dione (PubChem CID 19008744) has the molecular formula C9H16Na2O8P2 and a molecular weight of 360.15 g/mol. Its IUPAC name is disodium;1-dimethoxyphosphoryl-7-phosphonatoheptane-1,7-dione.
| Compound Name | disodium;1-dimethoxyphosphoryl-7-phosphonatoheptane-1,7-dione |
|---|---|
| PubChem CID | 19008744 |
| Molecular Formula | C9H16Na2O8P2 |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | disodium;1-dimethoxyphosphoryl-7-phosphonatoheptane-1,7-dione |
| SMILES | COP(=O)(OC)C(=O)CCCCCC(=O)P(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C9H18O8P2.2Na/c1-16-19(15,17-2)9(11)7-5-3-4-6-8(10)18(12,13)14;;/h3-7H2,1-2H3,(H2,12,13,14);;/q;2*+1/p-2 |
| InChIKey | FHXYSXZOCQUKGQ-UHFFFAOYSA-L |
| XLogP | -5.60 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|