C10H20O8P2 — CID 19008700
1,6-bis(dimethoxyphosphoryl)hexane-1,6-dione (PubChem CID 19008700) has the molecular formula C10H20O8P2 and a molecular weight of 330.21 g/mol. Its IUPAC name is 1,6-bis(dimethoxyphosphoryl)hexane-1,6-dione.
| Compound Name | 1,6-bis(dimethoxyphosphoryl)hexane-1,6-dione |
|---|---|
| PubChem CID | 19008700 |
| Molecular Formula | C10H20O8P2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1,6-bis(dimethoxyphosphoryl)hexane-1,6-dione |
| SMILES | COP(=O)(OC)C(=O)CCCCC(=O)P(=O)(OC)OC |
| InChI | InChI=1S/C10H20O8P2/c1-15-19(13,16-2)9(11)7-5-6-8-10(12)20(14,17-3)18-4/h5-8H2,1-4H3 |
| InChIKey | NGGNDBUMTDTXNB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|