C17H15ClN2O4S — CID 19010601
(Z)-2-[[6-[(4-chlorophenoxy)methyl]imidazo[2,1-b][1,3]thiazol-3-yl]methyl]-3-methoxyprop-2-enoic acid (PubChem CID 19010601) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is (Z)-2-[[6-[(4-chlorophenoxy)methyl]imidazo[2,1-b][1,3]thiazol-3-yl]methyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (Z)-2-[[6-[(4-chlorophenoxy)methyl]imidazo[2,1-b][1,3]thiazol-3-yl]methyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 19010601 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | (Z)-2-[[6-[(4-chlorophenoxy)methyl]imidazo[2,1-b][1,3]thiazol-3-yl]methyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/Cc1csc2nc(COc3ccc(Cl)cc3)cn12)C(=O)O |
| InChI | InChI=1S/C17H15ClN2O4S/c1-23-8-11(16(21)22)6-14-10-25-17-19-13(7-20(14)17)9-24-15-4-2-12(18)3-5-15/h2-5,7-8,10H,6,9H2,1H3,(H,21,22)/b11-8- |
| InChIKey | YWYHOTYUWGRCNF-FLIBITNWSA-N |
| XLogP | 3.79 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|