C13H9ClN2O2S — CID 10661360
2-[3-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid (PubChem CID 10661360) has the molecular formula C13H9ClN2O2S and a molecular weight of 292.75 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid.
| Compound Name | 2-[3-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid |
|---|---|
| PubChem CID | 10661360 |
| Molecular Formula | C13H9ClN2O2S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-[3-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid |
| SMILES | O=C(O)Cc1cn2c(-c3ccc(Cl)cc3)csc2n1 |
| InChI | InChI=1S/C13H9ClN2O2S/c14-9-3-1-8(2-4-9)11-7-19-13-15-10(5-12(17)18)6-16(11)13/h1-4,6-7H,5H2,(H,17,18) |
| InChIKey | QIYHBAWUUHJFPA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |