C14H10ClNO2S — CID 21426120
2-[6-(4-chlorophenyl)pyrrolo[2,1-b][1,3]thiazol-3-yl]acetic acid (PubChem CID 21426120) has the molecular formula C14H10ClNO2S and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)pyrrolo[2,1-b][1,3]thiazol-3-yl]acetic acid.
| Compound Name | 2-[6-(4-chlorophenyl)pyrrolo[2,1-b][1,3]thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 21426120 |
| Molecular Formula | C14H10ClNO2S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-[6-(4-chlorophenyl)pyrrolo[2,1-b][1,3]thiazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1csc2cc(-c3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C14H10ClNO2S/c15-11-3-1-9(2-4-11)10-5-13-16(7-10)12(8-19-13)6-14(17)18/h1-5,7-8H,6H2,(H,17,18) |
| InChIKey | KHOCGYHWWRODIH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |