2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid

C11H8N2O3S — CID 82035969

IUPAC2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid
SMILESO=C(O)Cc1cn2c(-c3ccco3)csc2n1
InChIInChI=1S/C11H8N2O3S/c14-10(15)4-7-5-13-8(6-17-11(13)12-7)9-2-1-3-16-9/h1-3,5-6H,4H2,(H,14,15)
InChIKeyUOZZTRRMEWFHFB-UHFFFAOYSA-N
MW248.26 g/mol
LogP2.28
Rot. Bonds3

About 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid

2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid (PubChem CID 82035969) has the molecular formula C11H8N2O3S and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid.

Molecular Properties

Compound Name2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid
PubChem CID82035969
Molecular FormulaC11H8N2O3S
Molecular Weight248.26 g/mol
Exact Mass248.03
IUPAC Name2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid
SMILESO=C(O)Cc1cn2c(-c3ccco3)csc2n1
InChIInChI=1S/C11H8N2O3S/c14-10(15)4-7-5-13-8(6-17-11(13)12-7)9-2-1-3-16-9/h1-3,5-6H,4H2,(H,14,15)
InChIKeyUOZZTRRMEWFHFB-UHFFFAOYSA-N
XLogP2.28
TPSA67.74 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.26
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid?
The IUPAC name of 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid (CID 82035969) is 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid.
What is the SMILES notation for 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid?
The canonical SMILES for 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid is O=C(O)Cc1cn2c(-c3ccco3)csc2n1.
What is the InChIKey of 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid?
The InChIKey is UOZZTRRMEWFHFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O3S/c14-10(15)4-7-5-13-8(6-17-11(13)12-7)9-2-1-3-16-9/h1-3,5-6H,4H2,(H,14,15).
What are the key properties of 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid?
2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid has a molecular weight of 248.26 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(furan-2-yl)imidazo[2,1-b][1,3]thiazol-6-yl]acetic acid is sourced from PubChem (CID 82035969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).