C15H10N2O4S — CID 93210596
2-[3,6-bis(furan-2-yl)imidazo[2,1-b][1,3]thiazol-5-yl]acetic acid (PubChem CID 93210596) has the molecular formula C15H10N2O4S and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-[3,6-bis(furan-2-yl)imidazo[2,1-b][1,3]thiazol-5-yl]acetic acid.
| Compound Name | 2-[3,6-bis(furan-2-yl)imidazo[2,1-b][1,3]thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 93210596 |
| Molecular Formula | C15H10N2O4S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-[3,6-bis(furan-2-yl)imidazo[2,1-b][1,3]thiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1c(-c2ccco2)nc2scc(-c3ccco3)n12 |
| InChI | InChI=1S/C15H10N2O4S/c18-13(19)7-9-14(12-4-2-6-21-12)16-15-17(9)10(8-22-15)11-3-1-5-20-11/h1-6,8H,7H2,(H,18,19) |
| InChIKey | KSTHSCAARIRPPH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |