C13H9ClN2OS — CID 39198944
3-(4-chlorophenyl)-6-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198944) has the molecular formula C13H9ClN2OS and a molecular weight of 276.75 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(4-chlorophenyl)-6-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198944 |
| Molecular Formula | C13H9ClN2OS |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 3-(4-chlorophenyl)-6-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | Cc1nc2scc(-c3ccc(Cl)cc3)n2c1C=O |
| InChI | InChI=1S/C13H9ClN2OS/c1-8-11(6-17)16-12(7-18-13(16)15-8)9-2-4-10(14)5-3-9/h2-7H,1H3 |
| InChIKey | ZKLCWYYKQJOOIM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|