C13H8Cl2N2OS — CID 39198971
3-(3,4-dichlorophenyl)-6-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198971) has the molecular formula C13H8Cl2N2OS and a molecular weight of 311.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-6-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(3,4-dichlorophenyl)-6-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198971 |
| Molecular Formula | C13H8Cl2N2OS |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-6-methylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | Cc1nc2scc(-c3ccc(Cl)c(Cl)c3)n2c1C=O |
| InChI | InChI=1S/C13H8Cl2N2OS/c1-7-11(5-18)17-12(6-19-13(17)16-7)8-2-3-9(14)10(15)4-8/h2-6H,1H3 |
| InChIKey | BWGUUBSEGTXESH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|