C12H11NO5 — CID 19013351
5-(4-methylphenyl)-1,2-oxazole;oxalic acid (PubChem CID 19013351) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 5-(4-methylphenyl)-1,2-oxazole;oxalic acid.
| Compound Name | 5-(4-methylphenyl)-1,2-oxazole;oxalic acid |
|---|---|
| PubChem CID | 19013351 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 5-(4-methylphenyl)-1,2-oxazole;oxalic acid |
| SMILES | Cc1ccc(-c2ccno2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H9NO.C2H2O4/c1-8-2-4-9(5-3-8)10-6-7-11-12-10;3-1(4)2(5)6/h2-7H,1H3;(H,3,4)(H,5,6) |
| InChIKey | YHLCXFBVCVEQCZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|