C25H36ClN2O2+ — CID 19016387
2-chloro-4-decoxy-N-[(1-ethylpyridin-1-ium-3-yl)methyl]benzamide (PubChem CID 19016387) has the molecular formula C25H36ClN2O2+ and a molecular weight of 432.03 g/mol. Its IUPAC name is 2-chloro-4-decoxy-N-[(1-ethylpyridin-1-ium-3-yl)methyl]benzamide.
| Compound Name | 2-chloro-4-decoxy-N-[(1-ethylpyridin-1-ium-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 19016387 |
| Molecular Formula | C25H36ClN2O2+ |
| Molecular Weight | 432.03 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 2-chloro-4-decoxy-N-[(1-ethylpyridin-1-ium-3-yl)methyl]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)NCc2ccc[n+](CC)c2)c(Cl)c1 |
| InChI | InChI=1S/C25H35ClN2O2/c1-3-5-6-7-8-9-10-11-17-30-22-14-15-23(24(26)18-22)25(29)27-19-21-13-12-16-28(4-2)20-21/h12-16,18,20H,3-11,17,19H2,1-2H3/p+1 |
| InChIKey | BJHMFKSFKRSUPN-UHFFFAOYSA-O |
| XLogP | 6.10 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.03 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|