C26H39N2O3+ — CID 19016436
4-decoxy-N-[(1-ethylpyridin-1-ium-4-yl)methyl]-2-methoxybenzamide (PubChem CID 19016436) has the molecular formula C26H39N2O3+ and a molecular weight of 427.61 g/mol. Its IUPAC name is 4-decoxy-N-[(1-ethylpyridin-1-ium-4-yl)methyl]-2-methoxybenzamide.
| Compound Name | 4-decoxy-N-[(1-ethylpyridin-1-ium-4-yl)methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 19016436 |
| Molecular Formula | C26H39N2O3+ |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.30 |
| IUPAC Name | 4-decoxy-N-[(1-ethylpyridin-1-ium-4-yl)methyl]-2-methoxybenzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)NCc2cc[n+](CC)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H38N2O3/c1-4-6-7-8-9-10-11-12-19-31-23-13-14-24(25(20-23)30-3)26(29)27-21-22-15-17-28(5-2)18-16-22/h13-18,20H,4-12,19,21H2,1-3H3/p+1 |
| InChIKey | NBOIYHVPNQFQTM-UHFFFAOYSA-O |
| XLogP | 5.45 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|