About (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate
(4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate (PubChem CID 19023761) has the molecular formula C15H16O2S2
and a molecular weight of 292.43 g/mol. Its IUPAC name is (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate.
Molecular Properties
| Compound Name | (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate |
| PubChem CID | 19023761 |
| Molecular Formula | C15H16O2S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate |
| SMILES | CCC(C(=O)Oc1ccc(C)cc1S)c1ccsc1 |
| InChI | InChI=1S/C15H16O2S2/c1-3-12(11-6-7-19-9-11)15(16)17-13-5-4-10(2)8-14(13)18/h4-9,12,18H,3H2,1-2H3 |
| InChIKey | KVGRTWCWJRHSKU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate?
The IUPAC name of (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate (CID 19023761) is (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate.
What is the SMILES notation for (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate?
The canonical SMILES for (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate is CCC(C(=O)Oc1ccc(C)cc1S)c1ccsc1.
What is the InChIKey of (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate?
The InChIKey is KVGRTWCWJRHSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2S2/c1-3-12(11-6-7-19-9-11)15(16)17-13-5-4-10(2)8-14(13)18/h4-9,12,18H,3H2,1-2H3.
What are the key properties of (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate?
(4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate has a molecular weight of 292.43 g/mol, XLogP of 4.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2-sulfanylphenyl) 2-thiophen-3-ylbutanoate is sourced from PubChem (CID 19023761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).