C29H33ClO — CID 19024843
3-[2,2-bis[4-(2-methylpropyl)phenyl]ethyl]benzoyl chloride (PubChem CID 19024843) has the molecular formula C29H33ClO and a molecular weight of 433.04 g/mol. Its IUPAC name is 3-[2,2-bis[4-(2-methylpropyl)phenyl]ethyl]benzoyl chloride.
| Compound Name | 3-[2,2-bis[4-(2-methylpropyl)phenyl]ethyl]benzoyl chloride |
|---|---|
| PubChem CID | 19024843 |
| Molecular Formula | C29H33ClO |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-[2,2-bis[4-(2-methylpropyl)phenyl]ethyl]benzoyl chloride |
| SMILES | CC(C)Cc1ccc(C(Cc2cccc(C(=O)Cl)c2)c2ccc(CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H33ClO/c1-20(2)16-22-8-12-25(13-9-22)28(19-24-6-5-7-27(18-24)29(30)31)26-14-10-23(11-15-26)17-21(3)4/h5-15,18,20-21,28H,16-17,19H2,1-4H3 |
| InChIKey | ZSIOGGDXUOPUPS-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|