C18H29FN2O2 — CID 19028244
N-ethylformamide;8-fluoro-N-propan-2-yl-N-propyl-3,4-dihydro-2H-chromen-3-amine (PubChem CID 19028244) has the molecular formula C18H29FN2O2 and a molecular weight of 324.44 g/mol. Its IUPAC name is N-ethylformamide;8-fluoro-N-propan-2-yl-N-propyl-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | N-ethylformamide;8-fluoro-N-propan-2-yl-N-propyl-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 19028244 |
| Molecular Formula | C18H29FN2O2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-ethylformamide;8-fluoro-N-propan-2-yl-N-propyl-3,4-dihydro-2H-chromen-3-amine |
| SMILES | CCCN(C(C)C)C1COc2c(F)cccc2C1.CCNC=O |
| InChI | InChI=1S/C15H22FNO.C3H7NO/c1-4-8-17(11(2)3)13-9-12-6-5-7-14(16)15(12)18-10-13;1-2-4-3-5/h5-7,11,13H,4,8-10H2,1-3H3;3H,2H2,1H3,(H,4,5) |
| InChIKey | QZUJOJOSMZYRDW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|