C11H20O — CID 19031169
(2E,5E)-3,4-dimethylnona-2,5-dien-1-ol (PubChem CID 19031169) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2E,5E)-3,4-dimethylnona-2,5-dien-1-ol.
| Compound Name | (2E,5E)-3,4-dimethylnona-2,5-dien-1-ol |
|---|---|
| PubChem CID | 19031169 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2E,5E)-3,4-dimethylnona-2,5-dien-1-ol |
| SMILES | CCC/C=C/C(C)/C(C)=C/CO |
| InChI | InChI=1S/C11H20O/c1-4-5-6-7-10(2)11(3)8-9-12/h6-8,10,12H,4-5,9H2,1-3H3/b7-6+,11-8+ |
| InChIKey | ZBDGULPRNZYQHG-HRCSPUOPSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|