C20H32N2O2 — CID 19032509
N-(4-tert-butylcyclohexyl)-3-methoxy-2-(prop-2-enoxymethyl)pyridin-4-amine (PubChem CID 19032509) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-3-methoxy-2-(prop-2-enoxymethyl)pyridin-4-amine.
| Compound Name | N-(4-tert-butylcyclohexyl)-3-methoxy-2-(prop-2-enoxymethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 19032509 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-3-methoxy-2-(prop-2-enoxymethyl)pyridin-4-amine |
| SMILES | C=CCOCc1nccc(NC2CCC(C(C)(C)C)CC2)c1OC |
| InChI | InChI=1S/C20H32N2O2/c1-6-13-24-14-18-19(23-5)17(11-12-21-18)22-16-9-7-15(8-10-16)20(2,3)4/h6,11-12,15-16H,1,7-10,13-14H2,2-5H3,(H,21,22) |
| InChIKey | LAKNLKPIIQBHDV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|