C19H32N2O — CID 19694045
3-ethoxy-2-methyl-N-[4-(2-methylbutan-2-yl)cyclohexyl]pyridin-4-amine (PubChem CID 19694045) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 3-ethoxy-2-methyl-N-[4-(2-methylbutan-2-yl)cyclohexyl]pyridin-4-amine.
| Compound Name | 3-ethoxy-2-methyl-N-[4-(2-methylbutan-2-yl)cyclohexyl]pyridin-4-amine |
|---|---|
| PubChem CID | 19694045 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 3-ethoxy-2-methyl-N-[4-(2-methylbutan-2-yl)cyclohexyl]pyridin-4-amine |
| SMILES | CCOc1c(NC2CCC(C(C)(C)CC)CC2)ccnc1C |
| InChI | InChI=1S/C19H32N2O/c1-6-19(4,5)15-8-10-16(11-9-15)21-17-12-13-20-14(3)18(17)22-7-2/h12-13,15-16H,6-11H2,1-5H3,(H,20,21) |
| InChIKey | IUCBEOQYVFDQIE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |