C17H25BrClN — CID 63423181
4-bromo-2-chloro-N-[4-(2-methylbutan-2-yl)cyclohexyl]aniline (PubChem CID 63423181) has the molecular formula C17H25BrClN and a molecular weight of 358.75 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-[4-(2-methylbutan-2-yl)cyclohexyl]aniline.
| Compound Name | 4-bromo-2-chloro-N-[4-(2-methylbutan-2-yl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 63423181 |
| Molecular Formula | C17H25BrClN |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-bromo-2-chloro-N-[4-(2-methylbutan-2-yl)cyclohexyl]aniline |
| SMILES | CCC(C)(C)C1CCC(Nc2ccc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C17H25BrClN/c1-4-17(2,3)12-5-8-14(9-6-12)20-16-10-7-13(18)11-15(16)19/h7,10-12,14,20H,4-6,8-9H2,1-3H3 |
| InChIKey | OMHQRZJTWVAHFT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |