C8H13S+ — CID 19033852
cyclohexa-1,3-dien-1-yl(dimethyl)sulfanium (PubChem CID 19033852) has the molecular formula C8H13S+ and a molecular weight of 141.26 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl(dimethyl)sulfanium.
| Compound Name | cyclohexa-1,3-dien-1-yl(dimethyl)sulfanium |
|---|---|
| PubChem CID | 19033852 |
| Molecular Formula | C8H13S+ |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl(dimethyl)sulfanium |
| SMILES | C[S+](C)C1=CC=CCC1 |
| InChI | InChI=1S/C8H13S/c1-9(2)8-6-4-3-5-7-8/h3-4,6H,5,7H2,1-2H3/q+1 |
| InChIKey | WPRWGLGYWYLQAJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|