C8H8S2 — CID 2762530
2-methylsulfanylcyclohepta-2,4,6-triene-1-thione (PubChem CID 2762530) has the molecular formula C8H8S2 and a molecular weight of 168.29 g/mol. Its IUPAC name is 2-methylsulfanylcyclohepta-2,4,6-triene-1-thione.
| Compound Name | 2-methylsulfanylcyclohepta-2,4,6-triene-1-thione |
|---|---|
| PubChem CID | 2762530 |
| Molecular Formula | C8H8S2 |
| Molecular Weight | 168.29 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 2-methylsulfanylcyclohepta-2,4,6-triene-1-thione |
| SMILES | CSc1cccccc1=S |
| InChI | InChI=1S/C8H8S2/c1-10-8-6-4-2-3-5-7(8)9/h2-6H,1H3 |
| InChIKey | GTDWDLRADNMJHQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|