C31H35N5O5 — CID 19037725
N-tert-butyl-N-[3-[(3-nitrophenyl)carbamoylamino]-2-oxo-5,7-diphenylazepan-1-yl]acetamide (PubChem CID 19037725) has the molecular formula C31H35N5O5 and a molecular weight of 557.65 g/mol. Its IUPAC name is N-tert-butyl-N-[3-[(3-nitrophenyl)carbamoylamino]-2-oxo-5,7-diphenylazepan-1-yl]acetamide.
| Compound Name | N-tert-butyl-N-[3-[(3-nitrophenyl)carbamoylamino]-2-oxo-5,7-diphenylazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 19037725 |
| Molecular Formula | C31H35N5O5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | N-tert-butyl-N-[3-[(3-nitrophenyl)carbamoylamino]-2-oxo-5,7-diphenylazepan-1-yl]acetamide |
| SMILES | CC(=O)N(N1C(=O)C(NC(=O)Nc2cccc([N+](=O)[O-])c2)CC(c2ccccc2)CC1c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H35N5O5/c1-21(37)35(31(2,3)4)34-28(23-14-9-6-10-15-23)19-24(22-12-7-5-8-13-22)18-27(29(34)38)33-30(39)32-25-16-11-17-26(20-25)36(40)41/h5-17,20,24,27-28H,18-19H2,1-4H3,(H2,32,33,39) |
| InChIKey | HNPRCBKGTYZFQJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|