C29H27F3N2O8S2 — CID 19038879
benzhydryl 3-methyl-4,4,7-trioxo-3-[(E)-3-pyridin-1-ium-1-ylprop-1-enyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;trifluoromethanesulfonate (PubChem CID 19038879) has the molecular formula C29H27F3N2O8S2 and a molecular weight of 652.67 g/mol. Its IUPAC name is benzhydryl 3-methyl-4,4,7-trioxo-3-[(E)-3-pyridin-1-ium-1-ylprop-1-enyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;trifluoromethanesulfonate.
| Compound Name | benzhydryl 3-methyl-4,4,7-trioxo-3-[(E)-3-pyridin-1-ium-1-ylprop-1-enyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19038879 |
| Molecular Formula | C29H27F3N2O8S2 |
| Molecular Weight | 652.67 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | benzhydryl 3-methyl-4,4,7-trioxo-3-[(E)-3-pyridin-1-ium-1-ylprop-1-enyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;trifluoromethanesulfonate |
| SMILES | CC1(/C=C/C[n+]2ccccc2)C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)CC2S1(=O)=O.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C28H27N2O5S.CHF3O3S/c1-28(16-11-19-29-17-9-4-10-18-29)26(30-23(31)20-24(30)36(28,33)34)27(32)35-25(21-12-5-2-6-13-21)22-14-7-3-8-15-22;2-1(3,4)8(5,6)7/h2-18,24-26H,19-20H2,1H3;(H,5,6,7)/q+1;/p-1/b16-11+; |
| InChIKey | GUOLGICLTSPLIX-YFMOEUEHSA-M |
| XLogP | 3.03 |
| TPSA | 141.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|