About CID 19039083
CID 19039083 (PubChem CID 19039083) has the molecular formula C18H24Cl2FOSi
and a molecular weight of 374.38 g/mol.
Molecular Properties
| Compound Name | CID 19039083 |
| PubChem CID | 19039083 |
| Molecular Formula | C18H24Cl2FOSi |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | — |
| SMILES | Fc1cc(OCC2CCC(C3CC[Si](Cl)CC3)CC2)ccc1Cl |
| InChI | InChI=1S/C18H24Cl2FOSi/c19-17-6-5-16(11-18(17)21)22-12-13-1-3-14(4-2-13)15-7-9-23(20)10-8-15/h5-6,11,13-15H,1-4,7-10,12H2 |
| InChIKey | FFLMASJJVPLVCS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 19039083 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19039083?
The IUPAC name of CID 19039083 (CID 19039083) is not available.
What is the SMILES notation for CID 19039083?
The canonical SMILES for CID 19039083 is Fc1cc(OCC2CCC(C3CC[Si](Cl)CC3)CC2)ccc1Cl.
What is the InChIKey of CID 19039083?
The InChIKey is FFLMASJJVPLVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24Cl2FOSi/c19-17-6-5-16(11-18(17)21)22-12-13-1-3-14(4-2-13)15-7-9-23(20)10-8-15/h5-6,11,13-15H,1-4,7-10,12H2.
What are the key properties of CID 19039083?
CID 19039083 has a molecular weight of 374.38 g/mol, XLogP of 6.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19039083 is sourced from PubChem (CID 19039083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).