C22H34ClOSi — CID 19039132
CID 19039132 (PubChem CID 19039132) has the molecular formula C22H34ClOSi and a molecular weight of 378.05 g/mol.
| Compound Name | CID 19039132 |
|---|---|
| PubChem CID | 19039132 |
| Molecular Formula | C22H34ClOSi |
| Molecular Weight | 378.05 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | — |
| SMILES | CCC[Si]1CCC(C2CCC(COc3ccc(Cl)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C22H34ClOSi/c1-3-12-25-13-10-20(11-14-25)19-6-4-18(5-7-19)16-24-21-8-9-22(23)17(2)15-21/h8-9,15,18-20H,3-7,10-14,16H2,1-2H3 |
| InChIKey | XSWYRIUHAAXPRU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.05 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|