4,4-dicyclohexylbutanoic acid

C16H28O2 — CID 19041232

IUPAC4,4-dicyclohexylbutanoic acid
SMILESO=C(O)CCC(C1CCCCC1)C1CCCCC1
InChIInChI=1S/C16H28O2/c17-16(18)12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h13-15H,1-12H2,(H,17,18)
InChIKeyMJKAJKTZNMSFCS-UHFFFAOYSA-N
MW252.40 g/mol
LogP4.63
Rot. Bonds5

About 4,4-dicyclohexylbutanoic acid

4,4-dicyclohexylbutanoic acid (PubChem CID 19041232) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 4,4-dicyclohexylbutanoic acid.

Molecular Properties

Compound Name4,4-dicyclohexylbutanoic acid
PubChem CID19041232
Molecular FormulaC16H28O2
Molecular Weight252.40 g/mol
Exact Mass252.21
IUPAC Name4,4-dicyclohexylbutanoic acid
SMILESO=C(O)CCC(C1CCCCC1)C1CCCCC1
InChIInChI=1S/C16H28O2/c17-16(18)12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h13-15H,1-12H2,(H,17,18)
InChIKeyMJKAJKTZNMSFCS-UHFFFAOYSA-N
XLogP4.63
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.40
LogP ≤ 54.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4,4-dicyclohexylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dicyclohexylbutanoic acid?
The IUPAC name of 4,4-dicyclohexylbutanoic acid (CID 19041232) is 4,4-dicyclohexylbutanoic acid.
What is the SMILES notation for 4,4-dicyclohexylbutanoic acid?
The canonical SMILES for 4,4-dicyclohexylbutanoic acid is O=C(O)CCC(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 4,4-dicyclohexylbutanoic acid?
The InChIKey is MJKAJKTZNMSFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c17-16(18)12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h13-15H,1-12H2,(H,17,18).
What are the key properties of 4,4-dicyclohexylbutanoic acid?
4,4-dicyclohexylbutanoic acid has a molecular weight of 252.40 g/mol, XLogP of 4.63, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dicyclohexylbutanoic acid is sourced from PubChem (CID 19041232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).