C19H12N2O3 — CID 19041985
5-hydroxy-4-methylidene-7-quinolin-2-ylisoquinoline-1,3-dione (PubChem CID 19041985) has the molecular formula C19H12N2O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 5-hydroxy-4-methylidene-7-quinolin-2-ylisoquinoline-1,3-dione.
| Compound Name | 5-hydroxy-4-methylidene-7-quinolin-2-ylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 19041985 |
| Molecular Formula | C19H12N2O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 5-hydroxy-4-methylidene-7-quinolin-2-ylisoquinoline-1,3-dione |
| SMILES | C=C1C(=O)NC(=O)c2cc(-c3ccc4ccccc4n3)cc(O)c21 |
| InChI | InChI=1S/C19H12N2O3/c1-10-17-13(19(24)21-18(10)23)8-12(9-16(17)22)15-7-6-11-4-2-3-5-14(11)20-15/h2-9,22H,1H2,(H,21,23,24) |
| InChIKey | ZTSMFYNGMIJQDE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|