C32H37N3O2S — CID 19055167
2-[6-(4-tert-butylphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 19055167) has the molecular formula C32H37N3O2S and a molecular weight of 527.73 g/mol. Its IUPAC name is 2-[6-(4-tert-butylphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[6-(4-tert-butylphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 19055167 |
| Molecular Formula | C32H37N3O2S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 2-[6-(4-tert-butylphenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(CC(=O)NCc1cccs1)C2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H37N3O2S/c1-31(2,3)22-14-12-21(13-15-22)30-29-25(17-32(4,5)18-27(29)36)34-24-10-6-7-11-26(24)35(30)20-28(37)33-19-23-9-8-16-38-23/h6-16,30,34H,17-20H2,1-5H3,(H,33,37) |
| InChIKey | TZNZPKZPXVIHDO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |