C32H37N3O5S — CID 19055723
2-[9,9-dimethyl-7-oxo-6-(3,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 19055723) has the molecular formula C32H37N3O5S and a molecular weight of 575.73 g/mol. Its IUPAC name is 2-[9,9-dimethyl-7-oxo-6-(3,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[9,9-dimethyl-7-oxo-6-(3,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 19055723 |
| Molecular Formula | C32H37N3O5S |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 2-[9,9-dimethyl-7-oxo-6-(3,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2CC(=O)NCCc2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C32H37N3O5S/c1-32(2)17-23-29(25(36)18-32)30(20-15-26(38-3)31(40-5)27(16-20)39-4)35(24-11-7-6-10-22(24)34-23)19-28(37)33-13-12-21-9-8-14-41-21/h6-11,14-16,30,34H,12-13,17-19H2,1-5H3,(H,33,37) |
| InChIKey | BGFXHTNGXIQWHY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |