C34H40N4O3 — CID 19056938
2-[6-[4-(dimethylamino)phenyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 19056938) has the molecular formula C34H40N4O3 and a molecular weight of 552.72 g/mol. Its IUPAC name is 2-[6-[4-(dimethylamino)phenyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[6-[4-(dimethylamino)phenyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 19056938 |
| Molecular Formula | C34H40N4O3 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | 2-[6-[4-(dimethylamino)phenyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CN2c3ccccc3NC3=C(C(=O)CC(C)(C)C3)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H40N4O3/c1-34(2)20-28-32(30(39)21-34)33(24-12-14-25(15-13-24)37(3)4)38(29-9-7-6-8-27(29)36-28)22-31(40)35-19-18-23-10-16-26(41-5)17-11-23/h6-17,33,36H,18-22H2,1-5H3,(H,35,40) |
| InChIKey | OYFJYWVISPOVHW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|