C17H14N2O3S — CID 19057256
phenacyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 19057256) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is phenacyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | phenacyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19057256 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | phenacyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | Cc1ccc2c(N)c(C(=O)OCC(=O)c3ccccc3)sc2n1 |
| InChI | InChI=1S/C17H14N2O3S/c1-10-7-8-12-14(18)15(23-16(12)19-10)17(21)22-9-13(20)11-5-3-2-4-6-11/h2-8H,9,18H2,1H3 |
| InChIKey | RLDMAYKINNCLGU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |