C12H12N2O3S — CID 2747019
ethyl 6-acetyl-3-aminothieno[2,3-b]pyridine-2-carboxylate (PubChem CID 2747019) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is ethyl 6-acetyl-3-aminothieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 6-acetyl-3-aminothieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 2747019 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | ethyl 6-acetyl-3-aminothieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(C(C)=O)ccc2c1N |
| InChI | InChI=1S/C12H12N2O3S/c1-3-17-12(16)10-9(13)7-4-5-8(6(2)15)14-11(7)18-10/h4-5H,3,13H2,1-2H3 |
| InChIKey | YUSVJLGKJRYGMF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |