C15H14N2O2S — CID 865150
ethyl 3-amino-8-methylthieno[2,3-b]quinoline-2-carboxylate (PubChem CID 865150) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is ethyl 3-amino-8-methylthieno[2,3-b]quinoline-2-carboxylate.
| Compound Name | ethyl 3-amino-8-methylthieno[2,3-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 865150 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | ethyl 3-amino-8-methylthieno[2,3-b]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1sc2nc3c(C)cccc3cc2c1N |
| InChI | InChI=1S/C15H14N2O2S/c1-3-19-15(18)13-11(16)10-7-9-6-4-5-8(2)12(9)17-14(10)20-13/h4-7H,3,16H2,1-2H3 |
| InChIKey | PHMLBKHBXWUKKC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |