C28H26N4O2S — CID 19058249
N-(1H-indol-6-yl)-2-[1-(4-methylphenyl)-5-oxo-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]acetamide (PubChem CID 19058249) has the molecular formula C28H26N4O2S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-(1H-indol-6-yl)-2-[1-(4-methylphenyl)-5-oxo-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]acetamide.
| Compound Name | N-(1H-indol-6-yl)-2-[1-(4-methylphenyl)-5-oxo-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 19058249 |
| Molecular Formula | C28H26N4O2S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-(1H-indol-6-yl)-2-[1-(4-methylphenyl)-5-oxo-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)C(CC(=O)Nc3ccc4cc[nH]c4c3)N(CCc3ccccc3)C2=S)cc1 |
| InChI | InChI=1S/C28H26N4O2S/c1-19-7-11-23(12-8-19)32-27(34)25(31(28(32)35)16-14-20-5-3-2-4-6-20)18-26(33)30-22-10-9-21-13-15-29-24(21)17-22/h2-13,15,17,25,29H,14,16,18H2,1H3,(H,30,33) |
| InChIKey | WIHBOHKWWCNANE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|