C23H23ClN4O2S — CID 19058200
2-[3-[2-(4-chlorophenyl)ethyl]-1-ethyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(1H-indol-6-yl)acetamide (PubChem CID 19058200) has the molecular formula C23H23ClN4O2S and a molecular weight of 454.98 g/mol. Its IUPAC name is 2-[3-[2-(4-chlorophenyl)ethyl]-1-ethyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(1H-indol-6-yl)acetamide.
| Compound Name | 2-[3-[2-(4-chlorophenyl)ethyl]-1-ethyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(1H-indol-6-yl)acetamide |
|---|---|
| PubChem CID | 19058200 |
| Molecular Formula | C23H23ClN4O2S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-[3-[2-(4-chlorophenyl)ethyl]-1-ethyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(1H-indol-6-yl)acetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc3cc[nH]c3c2)N(CCc2ccc(Cl)cc2)C1=S |
| InChI | InChI=1S/C23H23ClN4O2S/c1-2-27-22(30)20(28(23(27)31)12-10-15-3-6-17(24)7-4-15)14-21(29)26-18-8-5-16-9-11-25-19(16)13-18/h3-9,11,13,20,25H,2,10,12,14H2,1H3,(H,26,29) |
| InChIKey | DFKPHLUMKLTJFD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|