C14H16N2O5 — CID 19058874
2-(2,4-dimethoxyphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 19058874) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-(2,4-dimethoxyphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 19058874 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-(2,4-dimethoxyphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | COc1ccc(OCC(=O)Nc2cc(C)on2)c(OC)c1 |
| InChI | InChI=1S/C14H16N2O5/c1-9-6-13(16-21-9)15-14(17)8-20-11-5-4-10(18-2)7-12(11)19-3/h4-7H,8H2,1-3H3,(H,15,16,17) |
| InChIKey | FDRJVCVKVCMAPN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |