C22H24N2O4S — CID 19059416
(Z)-2-methyl-4-oxo-4-[4-[2-oxo-2-(4-propan-2-ylanilino)ethyl]sulfanylanilino]but-2-enoic acid (PubChem CID 19059416) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is (Z)-2-methyl-4-oxo-4-[4-[2-oxo-2-(4-propan-2-ylanilino)ethyl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (Z)-2-methyl-4-oxo-4-[4-[2-oxo-2-(4-propan-2-ylanilino)ethyl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 19059416 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (Z)-2-methyl-4-oxo-4-[4-[2-oxo-2-(4-propan-2-ylanilino)ethyl]sulfanylanilino]but-2-enoic acid |
| SMILES | C/C(=C/C(=O)Nc1ccc(SCC(=O)Nc2ccc(C(C)C)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H24N2O4S/c1-14(2)16-4-6-17(7-5-16)24-21(26)13-29-19-10-8-18(9-11-19)23-20(25)12-15(3)22(27)28/h4-12,14H,13H2,1-3H3,(H,23,25)(H,24,26)(H,27,28)/b15-12- |
| InChIKey | DBLKRVZCBSSRRK-QINSGFPZSA-N |
| XLogP | 4.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|