C21H20N2O4S — CID 19059406
(Z)-4-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-2-methyl-4-oxobut-2-enoic acid (PubChem CID 19059406) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is (Z)-4-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-2-methyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-2-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 19059406 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (Z)-4-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-2-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C/C(=O)Nc1ccc(SCC(=O)N2CCc3ccccc32)cc1)C(=O)O |
| InChI | InChI=1S/C21H20N2O4S/c1-14(21(26)27)12-19(24)22-16-6-8-17(9-7-16)28-13-20(25)23-11-10-15-4-2-3-5-18(15)23/h2-9,12H,10-11,13H2,1H3,(H,22,24)(H,26,27)/b14-12- |
| InChIKey | UNLICZDTUYCGQA-OWBHPGMISA-N |
| XLogP | 3.34 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|