C32H26BrN3O3S — CID 22193483
N-[(Z)-1-(3-bromophenyl)-3-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22193483) has the molecular formula C32H26BrN3O3S and a molecular weight of 612.55 g/mol. Its IUPAC name is N-[(Z)-1-(3-bromophenyl)-3-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-bromophenyl)-3-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193483 |
| Molecular Formula | C32H26BrN3O3S |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | N-[(Z)-1-(3-bromophenyl)-3-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)N2CCc3ccccc32)cc1)/C(=C/c1cccc(Br)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H26BrN3O3S/c33-25-11-6-7-22(19-25)20-28(35-31(38)24-9-2-1-3-10-24)32(39)34-26-13-15-27(16-14-26)40-21-30(37)36-18-17-23-8-4-5-12-29(23)36/h1-16,19-20H,17-18,21H2,(H,34,39)(H,35,38)/b28-20- |
| InChIKey | ZEYIVFIALRKVGM-RRAHZORUSA-N |
| XLogP | 6.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|