C32H26ClN3O3S — CID 22193266
N-[(Z)-1-(4-chlorophenyl)-3-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22193266) has the molecular formula C32H26ClN3O3S and a molecular weight of 568.10 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)-3-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)-3-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193266 |
| Molecular Formula | C32H26ClN3O3S |
| Molecular Weight | 568.10 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)-3-[4-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)N2CCc3ccccc32)cc1)/C(=C/c1ccc(Cl)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H26ClN3O3S/c33-25-12-10-22(11-13-25)20-28(35-31(38)24-7-2-1-3-8-24)32(39)34-26-14-16-27(17-15-26)40-21-30(37)36-19-18-23-6-4-5-9-29(23)36/h1-17,20H,18-19,21H2,(H,34,39)(H,35,38)/b28-20- |
| InChIKey | AQURPCDEYXSOSF-RRAHZORUSA-N |
| XLogP | 6.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.10 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|