C25H25N3O2S — CID 78776545
2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[4-(dimethylamino)phenyl]benzamide (PubChem CID 78776545) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[4-(dimethylamino)phenyl]benzamide.
| Compound Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[4-(dimethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 78776545 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[4-(dimethylamino)phenyl]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccccc2SCC(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C25H25N3O2S/c1-27(2)20-13-11-19(12-14-20)26-25(30)21-8-4-6-10-23(21)31-17-24(29)28-16-15-18-7-3-5-9-22(18)28/h3-14H,15-17H2,1-2H3,(H,26,30) |
| InChIKey | WCTLKWHTJJBZOY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|