C21H27NOS — CID 19062812
2-benzylsulfanyl-N-(2,4-dimethylpentan-3-yl)benzamide (PubChem CID 19062812) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(2,4-dimethylpentan-3-yl)benzamide.
| Compound Name | 2-benzylsulfanyl-N-(2,4-dimethylpentan-3-yl)benzamide |
|---|---|
| PubChem CID | 19062812 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-benzylsulfanyl-N-(2,4-dimethylpentan-3-yl)benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1SCc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H27NOS/c1-15(2)20(16(3)4)22-21(23)18-12-8-9-13-19(18)24-14-17-10-6-5-7-11-17/h5-13,15-16,20H,14H2,1-4H3,(H,22,23) |
| InChIKey | ZMDKHHQXFJPNFC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |