C24H27N3O4 — CID 19064680
N-[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzofuran-5-yl]-3-nitrobenzamide (PubChem CID 19064680) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzofuran-5-yl]-3-nitrobenzamide.
| Compound Name | N-[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzofuran-5-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 19064680 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[3-[1-(2-methylpropyl)piperidin-4-yl]-1-benzofuran-5-yl]-3-nitrobenzamide |
| SMILES | CC(C)CN1CCC(c2coc3ccc(NC(=O)c4cccc([N+](=O)[O-])c4)cc23)CC1 |
| InChI | InChI=1S/C24H27N3O4/c1-16(2)14-26-10-8-17(9-11-26)22-15-31-23-7-6-19(13-21(22)23)25-24(28)18-4-3-5-20(12-18)27(29)30/h3-7,12-13,15-17H,8-11,14H2,1-2H3,(H,25,28) |
| InChIKey | GCSAGRCWQZLGRT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|