C21H20F3N3 — CID 19065051
4-[5-piperidin-4-yl-2-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]pyridine (PubChem CID 19065051) has the molecular formula C21H20F3N3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 4-[5-piperidin-4-yl-2-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]pyridine.
| Compound Name | 4-[5-piperidin-4-yl-2-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]pyridine |
|---|---|
| PubChem CID | 19065051 |
| Molecular Formula | C21H20F3N3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-[5-piperidin-4-yl-2-[3-(trifluoromethyl)phenyl]-1H-pyrrol-3-yl]pyridine |
| SMILES | FC(F)(F)c1cccc(-c2[nH]c(C3CCNCC3)cc2-c2ccncc2)c1 |
| InChI | InChI=1S/C21H20F3N3/c22-21(23,24)17-3-1-2-16(12-17)20-18(14-4-8-25-9-5-14)13-19(27-20)15-6-10-26-11-7-15/h1-5,8-9,12-13,15,26-27H,6-7,10-11H2 |
| InChIKey | ROVWJCVPCFHULJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |